C19H26N2O3 — CID 75478030
(E)-N-[1-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-1-oxopropan-2-yl]-3-phenylprop-2-enamide (PubChem CID 75478030) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (E)-N-[1-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-1-oxopropan-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-1-oxopropan-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 75478030 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (E)-N-[1-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-1-oxopropan-2-yl]-3-phenylprop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccccc1)C(=O)N1CCC(C)(CO)CC1 |
| InChI | InChI=1S/C19H26N2O3/c1-15(18(24)21-12-10-19(2,14-22)11-13-21)20-17(23)9-8-16-6-4-3-5-7-16/h3-9,15,22H,10-14H2,1-2H3,(H,20,23)/b9-8+ |
| InChIKey | XPCUGVCDWYGZJL-CMDGGOBGSA-N |
| XLogP | 1.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|