C21H21F3N2O3S — CID 92692855
(3aR,6aR)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one (PubChem CID 92692855) has the molecular formula C21H21F3N2O3S and a molecular weight of 438.47 g/mol. Its IUPAC name is (3aR,6aR)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aR,6aR)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 92692855 |
| Molecular Formula | C21H21F3N2O3S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (3aR,6aR)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-[[3-(trifluoromethyl)phenyl]methyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
| SMILES | Cc1cc(C)cc(N2C(=O)N(Cc3cccc(C(F)(F)F)c3)[C@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C21H21F3N2O3S/c1-13-6-14(2)8-17(7-13)26-19-12-30(28,29)11-18(19)25(20(26)27)10-15-4-3-5-16(9-15)21(22,23)24/h3-9,18-19H,10-12H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | RPAQFZZWAXYVRF-OALUTQOASA-N |
| XLogP | 3.93 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|