C26H31N5O6 — CID 92695042
ethyl 4-[2-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbonyl]anilino]piperidine-1-carboxylate (PubChem CID 92695042) has the molecular formula C26H31N5O6 and a molecular weight of 509.56 g/mol. Its IUPAC name is ethyl 4-[2-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbonyl]anilino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbonyl]anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 92695042 |
| Molecular Formula | C26H31N5O6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | ethyl 4-[2-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbonyl]anilino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(C(=O)N3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H31N5O6/c1-2-37-26(34)28-10-8-20(9-11-28)27-21-7-6-18(13-23(21)31(35)36)25(33)29-14-17-12-19(16-29)22-4-3-5-24(32)30(22)15-17/h3-7,13,17,19-20,27H,2,8-12,14-16H2,1H3/t17-,19+/m1/s1 |
| InChIKey | IASDNMBEPIFSAJ-MJGOQNOKSA-N |
| XLogP | 3.05 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|