C18H25N3O4S — CID 92696395
(2S)-N-(3-ethoxypropyl)-2-morpholin-4-yl-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 92696395) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is (2S)-N-(3-ethoxypropyl)-2-morpholin-4-yl-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2S)-N-(3-ethoxypropyl)-2-morpholin-4-yl-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92696395 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (2S)-N-(3-ethoxypropyl)-2-morpholin-4-yl-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc2c(c1)NC(=O)[C@@H](N1CCOCC1)S2 |
| InChI | InChI=1S/C18H25N3O4S/c1-2-24-9-3-6-19-16(22)13-4-5-15-14(12-13)20-17(23)18(26-15)21-7-10-25-11-8-21/h4-5,12,18H,2-3,6-11H2,1H3,(H,19,22)(H,20,23)/t18-/m0/s1 |
| InChIKey | PQOWKIXUXKXUEQ-SFHVURJKSA-N |
| XLogP | 1.55 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|