C23H34N4O2S — CID 99736744
(2S)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-oxo-2-piperidin-1-yl-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 99736744) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is (2S)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-oxo-2-piperidin-1-yl-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2S)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-oxo-2-piperidin-1-yl-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 99736744 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (2S)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-oxo-2-piperidin-1-yl-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | C[C@@H]1CCCCN1CCCNC(=O)c1ccc2c(c1)NC(=O)[C@@H](N1CCCCC1)S2 |
| InChI | InChI=1S/C23H34N4O2S/c1-17-8-3-6-12-26(17)15-7-11-24-21(28)18-9-10-20-19(16-18)25-22(29)23(30-20)27-13-4-2-5-14-27/h9-10,16-17,23H,2-8,11-15H2,1H3,(H,24,28)(H,25,29)/t17-,23+/m1/s1 |
| InChIKey | FDHSAMVGGYCYTJ-HXOBKFHXSA-N |
| XLogP | 3.54 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|