C25H24BrClN2O2 — CID 92698281
2-[(2S,6S)-2-(5-bromo-2-methoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol (PubChem CID 92698281) has the molecular formula C25H24BrClN2O2 and a molecular weight of 499.84 g/mol. Its IUPAC name is 2-[(2S,6S)-2-(5-bromo-2-methoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol.
| Compound Name | 2-[(2S,6S)-2-(5-bromo-2-methoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 92698281 |
| Molecular Formula | C25H24BrClN2O2 |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 2-[(2S,6S)-2-(5-bromo-2-methoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
| SMILES | CCc1ccc(C2=N[C@@H](c3cc(Br)ccc3OC)N[C@H](c3cc(Cl)ccc3O)C2)cc1 |
| InChI | InChI=1S/C25H24BrClN2O2/c1-3-15-4-6-16(7-5-15)21-14-22(19-13-18(27)9-10-23(19)30)29-25(28-21)20-12-17(26)8-11-24(20)31-2/h4-13,22,25,29-30H,3,14H2,1-2H3/t22-,25+/m0/s1 |
| InChIKey | OEGGDIPMFVTORK-WIOPSUGQSA-N |
| XLogP | 6.60 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|