C26H28N2O3 — CID 94794188
2-[(2S,6S)-2-(2,5-dimethoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 94794188) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[(2S,6S)-2-(2,5-dimethoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[(2S,6S)-2-(2,5-dimethoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 94794188 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[(2S,6S)-2-(2,5-dimethoxyphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | CCc1ccc(C2=N[C@@H](c3cc(OC)ccc3OC)N[C@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-4-17-9-11-18(12-10-17)22-16-23(20-7-5-6-8-24(20)29)28-26(27-22)21-15-19(30-2)13-14-25(21)31-3/h5-15,23,26,28-29H,4,16H2,1-3H3/t23-,26+/m0/s1 |
| InChIKey | WWZBAFOYOGTTSW-JYFHCDHNSA-N |
| XLogP | 5.19 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|