C25H26N2O4 — CID 15996987
2-[2-(3,4-dimethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 15996987) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 15996987 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | COc1ccc(C2=NC(c3ccc(OC)c(OC)c3)NC(c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-29-18-11-8-16(9-12-18)20-15-21(19-6-4-5-7-22(19)28)27-25(26-20)17-10-13-23(30-2)24(14-17)31-3/h4-14,21,25,27-28H,15H2,1-3H3 |
| InChIKey | QGZVHQOOHACNRI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|