C21H20N2O2S — CID 23603272
2-[4-(4-methoxyphenyl)-2-thiophen-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 23603272) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-2-thiophen-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[4-(4-methoxyphenyl)-2-thiophen-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 23603272 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-2-thiophen-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | COc1ccc(C2=NC(c3ccsc3)NC(c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-25-16-8-6-14(7-9-16)18-12-19(17-4-2-3-5-20(17)24)23-21(22-18)15-10-11-26-13-15/h2-11,13,19,21,23-24H,12H2,1H3 |
| InChIKey | CWGSBCWWYSXVIT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|