C23H19BrClN3O3 — CID 92698302
4-bromo-2-[(2S,6S)-2-(4-chloro-3-nitrophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 92698302) has the molecular formula C23H19BrClN3O3 and a molecular weight of 500.78 g/mol. Its IUPAC name is 4-bromo-2-[(2S,6S)-2-(4-chloro-3-nitrophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-bromo-2-[(2S,6S)-2-(4-chloro-3-nitrophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 92698302 |
| Molecular Formula | C23H19BrClN3O3 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 4-bromo-2-[(2S,6S)-2-(4-chloro-3-nitrophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Cc1ccc(C2=N[C@@H](c3ccc(Cl)c([N+](=O)[O-])c3)N[C@H](c3cc(Br)ccc3O)C2)cc1 |
| InChI | InChI=1S/C23H19BrClN3O3/c1-13-2-4-14(5-3-13)19-12-20(17-11-16(24)7-9-22(17)29)27-23(26-19)15-6-8-18(25)21(10-15)28(30)31/h2-11,20,23,27,29H,12H2,1H3/t20-,23+/m0/s1 |
| InChIKey | VQCNFYVWJGVIRN-NZQKXSOJSA-N |
| XLogP | 6.25 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|