C23H29N3O — CID 92708760
(3S)-1-[(3-methoxyphenyl)methyl]-N-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-amine (PubChem CID 92708760) has the molecular formula C23H29N3O and a molecular weight of 363.50 g/mol. Its IUPAC name is (3S)-1-[(3-methoxyphenyl)methyl]-N-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-amine.
| Compound Name | (3S)-1-[(3-methoxyphenyl)methyl]-N-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 92708760 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (3S)-1-[(3-methoxyphenyl)methyl]-N-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-amine |
| SMILES | COc1cccc(CN2CCC[C@H](NCc3[nH]c4ccccc4c3C)C2)c1 |
| InChI | InChI=1S/C23H29N3O/c1-17-21-10-3-4-11-22(21)25-23(17)14-24-19-8-6-12-26(16-19)15-18-7-5-9-20(13-18)27-2/h3-5,7,9-11,13,19,24-25H,6,8,12,14-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | RCWZHBZHCLPGJH-IBGZPJMESA-N |
| XLogP | 4.24 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|