C19H15F3N2O — CID 92709455
(3R)-N-(3,4-difluorophenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide (PubChem CID 92709455) has the molecular formula C19H15F3N2O and a molecular weight of 344.34 g/mol. Its IUPAC name is (3R)-N-(3,4-difluorophenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide.
| Compound Name | (3R)-N-(3,4-difluorophenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 92709455 |
| Molecular Formula | C19H15F3N2O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (3R)-N-(3,4-difluorophenyl)-3-(3-fluorophenyl)-3-pyrrol-1-ylpropanamide |
| SMILES | O=C(C[C@H](c1cccc(F)c1)n1cccc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H15F3N2O/c20-14-5-3-4-13(10-14)18(24-8-1-2-9-24)12-19(25)23-15-6-7-16(21)17(22)11-15/h1-11,18H,12H2,(H,23,25)/t18-/m1/s1 |
| InChIKey | MKLKAPYWKVIZHS-GOSISDBHSA-N |
| XLogP | 4.52 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |