C22H31N3O3S — CID 92710369
N-[2-methyl-5-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide (PubChem CID 92710369) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-[2-methyl-5-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide.
| Compound Name | N-[2-methyl-5-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide |
|---|---|
| PubChem CID | 92710369 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[2-methyl-5-[3-[(2S)-2-methylpiperidin-1-yl]propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCN2CCCC[C@@H]2C)cc1NC(=O)C1=CSCCO1 |
| InChI | InChI=1S/C22H31N3O3S/c1-16-7-8-18(14-19(16)24-22(27)20-15-29-13-12-28-20)21(26)23-9-5-11-25-10-4-3-6-17(25)2/h7-8,14-15,17H,3-6,9-13H2,1-2H3,(H,23,26)(H,24,27)/t17-/m0/s1 |
| InChIKey | NZNPYBIXDOHCND-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|