C26H34N4O4S — CID 92710468
(2S)-1-acetyl-N-[4-(diethylamino)-2-methylphenyl]-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide (PubChem CID 92710468) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[4-(diethylamino)-2-methylphenyl]-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-[4-(diethylamino)-2-methylphenyl]-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 92710468 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (2S)-1-acetyl-N-[4-(diethylamino)-2-methylphenyl]-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)[C@@H]2Cc3cc(S(=O)(=O)N4CCCC4)ccc3N2C(C)=O)c(C)c1 |
| InChI | InChI=1S/C26H34N4O4S/c1-5-28(6-2)21-9-11-23(18(3)15-21)27-26(32)25-17-20-16-22(10-12-24(20)30(25)19(4)31)35(33,34)29-13-7-8-14-29/h9-12,15-16,25H,5-8,13-14,17H2,1-4H3,(H,27,32)/t25-/m0/s1 |
| InChIKey | OUZSYSCNMXZARM-VWLOTQADSA-N |
| XLogP | 3.54 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|