C18H16ClN3O4 — CID 92712557
1-[(2S)-5-(4-chlorophenyl)-2-methyl-2-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 92712557) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is 1-[(2S)-5-(4-chlorophenyl)-2-methyl-2-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-5-(4-chlorophenyl)-2-methyl-2-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 92712557 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 1-[(2S)-5-(4-chlorophenyl)-2-methyl-2-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2ccc(Cl)cc2)O[C@@]1(C)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16ClN3O4/c1-11-4-7-14(10-16(11)22(24)25)18(3)21(12(2)23)20-17(26-18)13-5-8-15(19)9-6-13/h4-10H,1-3H3/t18-/m0/s1 |
| InChIKey | QISHJGMDIPYTGE-SFHVURJKSA-N |
| XLogP | 3.97 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|