C21H17FN4O4 — CID 92713736
(7R)-6-[(4-fluorophenyl)methyl]-7-(4-methoxy-2-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 92713736) has the molecular formula C21H17FN4O4 and a molecular weight of 408.39 g/mol. Its IUPAC name is (7R)-6-[(4-fluorophenyl)methyl]-7-(4-methoxy-2-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (7R)-6-[(4-fluorophenyl)methyl]-7-(4-methoxy-2-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 92713736 |
| Molecular Formula | C21H17FN4O4 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (7R)-6-[(4-fluorophenyl)methyl]-7-(4-methoxy-2-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1ccc(N[C@H]2c3ncccc3C(=O)N2Cc2ccc(F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17FN4O4/c1-30-15-8-9-17(18(11-15)26(28)29)24-20-19-16(3-2-10-23-19)21(27)25(20)12-13-4-6-14(22)7-5-13/h2-11,20,24H,12H2,1H3/t20-/m1/s1 |
| InChIKey | JWHQQZGWKDBMDQ-HXUWFJFHSA-N |
| XLogP | 3.90 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|