C20H15FN4O3 — CID 92713739
(7S)-6-[(4-fluorophenyl)methyl]-7-(3-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 92713739) has the molecular formula C20H15FN4O3 and a molecular weight of 378.36 g/mol. Its IUPAC name is (7S)-6-[(4-fluorophenyl)methyl]-7-(3-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (7S)-6-[(4-fluorophenyl)methyl]-7-(3-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 92713739 |
| Molecular Formula | C20H15FN4O3 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (7S)-6-[(4-fluorophenyl)methyl]-7-(3-nitroanilino)-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1c2cccnc2[C@@H](Nc2cccc([N+](=O)[O-])c2)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN4O3/c21-14-8-6-13(7-9-14)12-24-19(18-17(20(24)26)5-2-10-22-18)23-15-3-1-4-16(11-15)25(27)28/h1-11,19,23H,12H2/t19-/m0/s1 |
| InChIKey | CDYYIHZRJSVHLW-IBGZPJMESA-N |
| XLogP | 3.90 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|