C27H21ClN4O3 — CID 92721100
(9S)-17-(4-chlorophenyl)-9-(3-hydroxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 92721100) has the molecular formula C27H21ClN4O3 and a molecular weight of 484.94 g/mol. Its IUPAC name is (9S)-17-(4-chlorophenyl)-9-(3-hydroxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | (9S)-17-(4-chlorophenyl)-9-(3-hydroxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 92721100 |
| Molecular Formula | C27H21ClN4O3 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (9S)-17-(4-chlorophenyl)-9-(3-hydroxyphenyl)-12,14-dimethyl-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | Cn1c(=O)c2c(-c3ccc(Cl)cc3)n3c(c2n(C)c1=O)[C@H](c1cccc(O)c1)Nc1ccccc1-3 |
| InChI | InChI=1S/C27H21ClN4O3/c1-30-24-21(26(34)31(2)27(30)35)23(15-10-12-17(28)13-11-15)32-20-9-4-3-8-19(20)29-22(25(24)32)16-6-5-7-18(33)14-16/h3-14,22,29,33H,1-2H3/t22-/m0/s1 |
| InChIKey | LRJZJMITNIJEMC-QFIPXVFZSA-N |
| XLogP | 4.57 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |