C22H21NO2 — CID 92723325
3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 92723325) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 92723325 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1cc(C)c(-c2c(N3c4ccccc4C[C@@H]3C)c(=O)c2=O)cc1C |
| InChI | InChI=1S/C22H21NO2/c1-12-9-14(3)17(10-13(12)2)19-20(22(25)21(19)24)23-15(4)11-16-7-5-6-8-18(16)23/h5-10,15H,11H2,1-4H3/t15-/m0/s1 |
| InChIKey | CAQVZPDPBUEASJ-HNNXBMFYSA-N |
| XLogP | 3.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|