C29H26N4O4 — CID 92727380
(9R)-9-(2-hydroxy-5-methoxyphenyl)-12,14-dimethyl-17-(3-methylphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 92727380) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is (9R)-9-(2-hydroxy-5-methoxyphenyl)-12,14-dimethyl-17-(3-methylphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | (9R)-9-(2-hydroxy-5-methoxyphenyl)-12,14-dimethyl-17-(3-methylphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 92727380 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | (9R)-9-(2-hydroxy-5-methoxyphenyl)-12,14-dimethyl-17-(3-methylphenyl)-1,8,12,14-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | COc1ccc(O)c([C@H]2Nc3ccccc3-n3c(-c4cccc(C)c4)c4c(=O)n(C)c(=O)n(C)c4c32)c1 |
| InChI | InChI=1S/C29H26N4O4/c1-16-8-7-9-17(14-16)25-23-26(31(2)29(36)32(3)28(23)35)27-24(19-15-18(37-4)12-13-22(19)34)30-20-10-5-6-11-21(20)33(25)27/h5-15,24,30,34H,1-4H3/t24-/m1/s1 |
| InChIKey | WBTSOTMEBXKFQB-XMMPIXPASA-N |
| XLogP | 4.23 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|