C23H29N3O4S — CID 92728373
(2S)-N-butyl-1-[3-[(2-methylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide (PubChem CID 92728373) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is (2S)-N-butyl-1-[3-[(2-methylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-butyl-1-[3-[(2-methylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92728373 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (2S)-N-butyl-1-[3-[(2-methylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN1C(=O)c1cccc(NS(=O)(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C23H29N3O4S/c1-3-4-14-24-22(27)20-12-8-15-26(20)23(28)18-10-7-11-19(16-18)25-31(29,30)21-13-6-5-9-17(21)2/h5-7,9-11,13,16,20,25H,3-4,8,12,14-15H2,1-2H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | FYJRYKYRSVDTKU-FQEVSTJZSA-N |
| XLogP | 3.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|