C25H33N3O4S — CID 92728376
(2R)-N-butyl-1-[3-[(2,4,5-trimethylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide (PubChem CID 92728376) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is (2R)-N-butyl-1-[3-[(2,4,5-trimethylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-butyl-1-[3-[(2,4,5-trimethylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92728376 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2R)-N-butyl-1-[3-[(2,4,5-trimethylphenyl)sulfonylamino]benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CCCN1C(=O)c1cccc(NS(=O)(=O)c2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C25H33N3O4S/c1-5-6-12-26-24(29)22-11-8-13-28(22)25(30)20-9-7-10-21(16-20)27-33(31,32)23-15-18(3)17(2)14-19(23)4/h7,9-10,14-16,22,27H,5-6,8,11-13H2,1-4H3,(H,26,29)/t22-/m1/s1 |
| InChIKey | HNJMRWJFKPILSQ-JOCHJYFZSA-N |
| XLogP | 3.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|