C18H31N3O3 — CID 92734259
(2R)-N-cyclopentyl-2-methyl-1-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 92734259) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-methyl-1-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-cyclopentyl-2-methyl-1-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92734259 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (2R)-N-cyclopentyl-2-methyl-1-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | C[C@]1(C(=O)NC2CCCC2)CCC(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C18H31N3O3/c1-18(17(23)19-15-5-2-3-6-15)8-7-16(22)21(18)10-4-9-20-11-13-24-14-12-20/h15H,2-14H2,1H3,(H,19,23)/t18-/m1/s1 |
| InChIKey | RKWRNUWTVBIXDM-GOSISDBHSA-N |
| XLogP | 1.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |