C18H31N3O3 — CID 108973625
1-N'-cycloheptyl-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108973625) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-N'-cycloheptyl-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-cycloheptyl-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108973625 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 1-N'-cycloheptyl-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1(C(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H31N3O3/c22-16(19-9-10-21-11-13-24-14-12-21)18(7-8-18)17(23)20-15-5-3-1-2-4-6-15/h15H,1-14H2,(H,19,22)(H,20,23) |
| InChIKey | IFVSXKVWLAPQLY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|