C16H28N2O2 — CID 108971049
1-N-butyl-1-N'-cycloheptylcyclopropane-1,1-dicarboxamide (PubChem CID 108971049) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-N-butyl-1-N'-cycloheptylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-butyl-1-N'-cycloheptylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108971049 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-N-butyl-1-N'-cycloheptylcyclopropane-1,1-dicarboxamide |
| SMILES | CCCCNC(=O)C1(C(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C16H28N2O2/c1-2-3-12-17-14(19)16(10-11-16)15(20)18-13-8-6-4-5-7-9-13/h13H,2-12H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | PGVRRWJSSLSNEV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|