C28H35N3O4 — CID 92737803
(11R)-11-methyl-N-(4-methylcyclohexyl)-9-oxo-10-[(4-propoxyphenyl)methyl]-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92737803) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is (11R)-11-methyl-N-(4-methylcyclohexyl)-9-oxo-10-[(4-propoxyphenyl)methyl]-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11R)-11-methyl-N-(4-methylcyclohexyl)-9-oxo-10-[(4-propoxyphenyl)methyl]-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92737803 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | (11R)-11-methyl-N-(4-methylcyclohexyl)-9-oxo-10-[(4-propoxyphenyl)methyl]-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CCCOc1ccc(CN2C(=O)c3cc4occc4n3C[C@]2(C)C(=O)NC2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O4/c1-4-14-34-22-11-7-20(8-12-22)17-31-26(32)24-16-25-23(13-15-35-25)30(24)18-28(31,3)27(33)29-21-9-5-19(2)6-10-21/h7-8,11-13,15-16,19,21H,4-6,9-10,14,17-18H2,1-3H3,(H,29,33)/t19?,21?,28-/m1/s1 |
| InChIKey | LYNQNBWOUGLCGW-IWWPJXLMSA-N |
| XLogP | 5.13 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |