C29H29ClN4O3 — CID 92741606
(3R)-N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)phenyl]methyl]-6-(furan-2-yl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 92741606) has the molecular formula C29H29ClN4O3 and a molecular weight of 517.03 g/mol. Its IUPAC name is (3R)-N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)phenyl]methyl]-6-(furan-2-yl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | (3R)-N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)phenyl]methyl]-6-(furan-2-yl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 92741606 |
| Molecular Formula | C29H29ClN4O3 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | (3R)-N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)phenyl]methyl]-6-(furan-2-yl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | CN(C)c1ccc(CN2C(=O)c3ccc(-c4ccco4)n3C[C@]2(C)C(=O)NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H29ClN4O3/c1-29(28(36)31-17-20-6-10-22(30)11-7-20)19-33-24(26-5-4-16-37-26)14-15-25(33)27(35)34(29)18-21-8-12-23(13-9-21)32(2)3/h4-16H,17-19H2,1-3H3,(H,31,36)/t29-/m1/s1 |
| InChIKey | MVVDXBTVACJEIG-GDLZYMKVSA-N |
| XLogP | 5.20 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|