C24H27N3O4 — CID 92741572
(3R)-N-benzyl-6-(furan-2-yl)-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 92741572) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (3R)-N-benzyl-6-(furan-2-yl)-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | (3R)-N-benzyl-6-(furan-2-yl)-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 92741572 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (3R)-N-benzyl-6-(furan-2-yl)-2-(3-methoxypropyl)-3-methyl-1-oxo-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(-c3ccco3)n2C[C@]1(C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O4/c1-24(23(29)25-16-18-8-4-3-5-9-18)17-26-19(21-10-6-15-31-21)11-12-20(26)22(28)27(24)13-7-14-30-2/h3-6,8-12,15H,7,13-14,16-17H2,1-2H3,(H,25,29)/t24-/m1/s1 |
| InChIKey | HJHXNKJXFSXITR-XMMPIXPASA-N |
| XLogP | 3.32 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|