C18H17N3O — CID 92754338
(E,2R)-1-imidazol-1-yl-4-phenyl-2-pyridin-2-ylbut-3-en-2-ol (PubChem CID 92754338) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is (E,2R)-1-imidazol-1-yl-4-phenyl-2-pyridin-2-ylbut-3-en-2-ol.
| Compound Name | (E,2R)-1-imidazol-1-yl-4-phenyl-2-pyridin-2-ylbut-3-en-2-ol |
|---|---|
| PubChem CID | 92754338 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (E,2R)-1-imidazol-1-yl-4-phenyl-2-pyridin-2-ylbut-3-en-2-ol |
| SMILES | O[C@](/C=C/c1ccccc1)(Cn1ccnc1)c1ccccn1 |
| InChI | InChI=1S/C18H17N3O/c22-18(14-21-13-12-19-15-21,17-8-4-5-11-20-17)10-9-16-6-2-1-3-7-16/h1-13,15,22H,14H2/b10-9+/t18-/m1/s1 |
| InChIKey | ZNBAWCRBLQBEDB-QZEKMECESA-N |
| XLogP | 2.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |