C22H17NO — CID 11702330
(E)-1,5-diphenyl-3-pyridin-2-ylpent-1-en-4-yn-3-ol (PubChem CID 11702330) has the molecular formula C22H17NO and a molecular weight of 311.38 g/mol. Its IUPAC name is (E)-1,5-diphenyl-3-pyridin-2-ylpent-1-en-4-yn-3-ol.
| Compound Name | (E)-1,5-diphenyl-3-pyridin-2-ylpent-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 11702330 |
| Molecular Formula | C22H17NO |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (E)-1,5-diphenyl-3-pyridin-2-ylpent-1-en-4-yn-3-ol |
| SMILES | OC(C#Cc1ccccc1)(/C=C/c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C22H17NO/c24-22(21-13-7-8-18-23-21,16-14-19-9-3-1-4-10-19)17-15-20-11-5-2-6-12-20/h1-14,16,18,24H/b16-14+ |
| InChIKey | ARSDCKUAROGSSM-JQIJEIRASA-N |
| XLogP | 4.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|