C23H22O — CID 11522533
(E)-3-(cyclohexen-1-yl)-1,5-diphenylpent-1-en-4-yn-3-ol (PubChem CID 11522533) has the molecular formula C23H22O and a molecular weight of 314.43 g/mol. Its IUPAC name is (E)-3-(cyclohexen-1-yl)-1,5-diphenylpent-1-en-4-yn-3-ol.
| Compound Name | (E)-3-(cyclohexen-1-yl)-1,5-diphenylpent-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 11522533 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (E)-3-(cyclohexen-1-yl)-1,5-diphenylpent-1-en-4-yn-3-ol |
| SMILES | OC(C#Cc1ccccc1)(/C=C/c1ccccc1)C1=CCCCC1 |
| InChI | InChI=1S/C23H22O/c24-23(22-14-8-3-9-15-22,18-16-20-10-4-1-5-11-20)19-17-21-12-6-2-7-13-21/h1-2,4-7,10-14,16,18,24H,3,8-9,15H2/b18-16+ |
| InChIKey | AEDNSQCROIMKGJ-FBMGVBCBSA-N |
| XLogP | 4.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|