C18H20 — CID 102046787
[(E)-5-(cyclopenten-1-yl)-3,3-dimethylpent-1-en-4-ynyl]benzene (PubChem CID 102046787) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is [(E)-5-(cyclopenten-1-yl)-3,3-dimethylpent-1-en-4-ynyl]benzene.
| Compound Name | [(E)-5-(cyclopenten-1-yl)-3,3-dimethylpent-1-en-4-ynyl]benzene |
|---|---|
| PubChem CID | 102046787 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | [(E)-5-(cyclopenten-1-yl)-3,3-dimethylpent-1-en-4-ynyl]benzene |
| SMILES | CC(C)(C#CC1=CCCC1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H20/c1-18(2,15-13-17-10-6-7-11-17)14-12-16-8-4-3-5-9-16/h3-5,8-10,12,14H,6-7,11H2,1-2H3/b14-12+ |
| InChIKey | HYTRTMJTHYZTRJ-WYMLVPIESA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|