About (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile
(E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile (PubChem CID 146167998) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile.
Molecular Properties
| Compound Name | (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile |
| PubChem CID | 146167998 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile |
| SMILES | CC(C)(C#N)/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N/c1-18(2,14-19)13-12-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h3-13H,1-2H3/b13-12+ |
| InChIKey | JGYIASZBDPKXEX-OUKQBFOZSA-N |
| XLogP | 4.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile?
The IUPAC name of (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile (CID 146167998) is (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile.
What is the SMILES notation for (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile?
The canonical SMILES for (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile is CC(C)(C#N)/C=C/c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile?
The InChIKey is JGYIASZBDPKXEX-OUKQBFOZSA-N. The full InChI is InChI=1S/C18H17N/c1-18(2,14-19)13-12-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h3-13H,1-2H3/b13-12+.
What are the key properties of (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile?
(E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile has a molecular weight of 247.34 g/mol, XLogP of 4.92, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile is sourced from PubChem (CID 146167998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).