C18H17N — CID 146167998
(E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile (PubChem CID 146167998) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile.
| Compound Name | (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile |
|---|---|
| PubChem CID | 146167998 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (E)-2,2-dimethyl-4-(4-phenylphenyl)but-3-enenitrile |
| SMILES | CC(C)(C#N)/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N/c1-18(2,14-19)13-12-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h3-13H,1-2H3/b13-12+ |
| InChIKey | JGYIASZBDPKXEX-OUKQBFOZSA-N |
| XLogP | 4.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |