C23H36ClN3O4S — CID 92759632
6-chloro-1-[4-[2-methoxy-5-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]piperazin-1-yl]hexan-1-one (PubChem CID 92759632) has the molecular formula C23H36ClN3O4S and a molecular weight of 486.08 g/mol. Its IUPAC name is 6-chloro-1-[4-[2-methoxy-5-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 6-chloro-1-[4-[2-methoxy-5-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 92759632 |
| Molecular Formula | C23H36ClN3O4S |
| Molecular Weight | 486.08 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 6-chloro-1-[4-[2-methoxy-5-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]piperazin-1-yl]hexan-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H](C)C2)cc1N1CCN(C(=O)CCCCCCl)CC1 |
| InChI | InChI=1S/C23H36ClN3O4S/c1-19-7-6-12-27(18-19)32(29,30)20-9-10-22(31-2)21(17-20)25-13-15-26(16-14-25)23(28)8-4-3-5-11-24/h9-10,17,19H,3-8,11-16,18H2,1-2H3/t19-/m1/s1 |
| InChIKey | UGDRBJSEGMPPIW-LJQANCHMSA-N |
| XLogP | 3.56 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.08 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|