C28H40ClN3O6S — CID 46088655
3-[4-(6-chlorohexanoyl)piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 46088655) has the molecular formula C28H40ClN3O6S and a molecular weight of 582.16 g/mol. Its IUPAC name is 3-[4-(6-chlorohexanoyl)piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 3-[4-(6-chlorohexanoyl)piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46088655 |
| Molecular Formula | C28H40ClN3O6S |
| Molecular Weight | 582.16 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 3-[4-(6-chlorohexanoyl)piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(CCN(C)S(=O)(=O)c2ccc(OC)c(N3CCN(C(=O)CCCCCCl)CC3)c2)cc1OC |
| InChI | InChI=1S/C28H40ClN3O6S/c1-30(15-13-22-9-11-26(37-3)27(20-22)38-4)39(34,35)23-10-12-25(36-2)24(21-23)31-16-18-32(19-17-31)28(33)8-6-5-7-14-29/h9-12,20-21H,5-8,13-19H2,1-4H3 |
| InChIKey | MXMOFTFOGHJDJD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|