C22H28N2O3 — CID 92760139
8-methoxy-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide (PubChem CID 92760139) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 8-methoxy-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide.
| Compound Name | 8-methoxy-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 92760139 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 8-methoxy-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
| SMILES | COc1ccc2c(c1)-c1onc(C(=O)N[C@@H]3C[C@@H](C)CC(C)(C)C3)c1CC2 |
| InChI | InChI=1S/C22H28N2O3/c1-13-9-15(12-22(2,3)11-13)23-21(25)19-17-8-6-14-5-7-16(26-4)10-18(14)20(17)27-24-19/h5,7,10,13,15H,6,8-9,11-12H2,1-4H3,(H,23,25)/t13-,15-/m1/s1 |
| InChIKey | SAIBBHAJSCCSER-UKRRQHHQSA-N |
| XLogP | 4.39 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |