C20H23FN2OS — CID 92763826
1-[(5S)-9-fluoro-3-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-methylpiperazine (PubChem CID 92763826) has the molecular formula C20H23FN2OS and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-[(5S)-9-fluoro-3-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-methylpiperazine.
| Compound Name | 1-[(5S)-9-fluoro-3-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 92763826 |
| Molecular Formula | C20H23FN2OS |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[(5S)-9-fluoro-3-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]-4-methylpiperazine |
| SMILES | COc1ccc2c(c1)[C@@H](N1CCN(C)CC1)Cc1ccc(F)cc1S2 |
| InChI | InChI=1S/C20H23FN2OS/c1-22-7-9-23(10-8-22)18-11-14-3-4-15(21)12-20(14)25-19-6-5-16(24-2)13-17(18)19/h3-6,12-13,18H,7-11H2,1-2H3/t18-/m0/s1 |
| InChIKey | BDHGVPCSJFFQKK-SFHVURJKSA-N |
| XLogP | 3.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|