C26H28F2N2O3 — CID 92768665
3-[[4-[2-[(S)-(3,4-difluorophenyl)-phenylmethoxy]ethyl]piperazin-1-yl]methyl]benzene-1,2-diol (PubChem CID 92768665) has the molecular formula C26H28F2N2O3 and a molecular weight of 454.52 g/mol. Its IUPAC name is 3-[[4-[2-[(S)-(3,4-difluorophenyl)-phenylmethoxy]ethyl]piperazin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 3-[[4-[2-[(S)-(3,4-difluorophenyl)-phenylmethoxy]ethyl]piperazin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 92768665 |
| Molecular Formula | C26H28F2N2O3 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 3-[[4-[2-[(S)-(3,4-difluorophenyl)-phenylmethoxy]ethyl]piperazin-1-yl]methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CN2CCN(CCO[C@@H](c3ccccc3)c3ccc(F)c(F)c3)CC2)c1O |
| InChI | InChI=1S/C26H28F2N2O3/c27-22-10-9-20(17-23(22)28)26(19-5-2-1-3-6-19)33-16-15-29-11-13-30(14-12-29)18-21-7-4-8-24(31)25(21)32/h1-10,17,26,31-32H,11-16,18H2/t26-/m0/s1 |
| InChIKey | XNUWPGOUCKWTNQ-SANMLTNESA-N |
| XLogP | 4.30 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|