C27H33N3O3 — CID 92768930
ethyl 5-tert-butyl-1-[4-[[(2S)-4-phenylbutan-2-yl]carbamoyl]phenyl]pyrazole-3-carboxylate (PubChem CID 92768930) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1-[4-[[(2S)-4-phenylbutan-2-yl]carbamoyl]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-tert-butyl-1-[4-[[(2S)-4-phenylbutan-2-yl]carbamoyl]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 92768930 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | ethyl 5-tert-butyl-1-[4-[[(2S)-4-phenylbutan-2-yl]carbamoyl]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)(C)C)n(-c2ccc(C(=O)N[C@@H](C)CCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H33N3O3/c1-6-33-26(32)23-18-24(27(3,4)5)30(29-23)22-16-14-21(15-17-22)25(31)28-19(2)12-13-20-10-8-7-9-11-20/h7-11,14-19H,6,12-13H2,1-5H3,(H,28,31)/t19-/m0/s1 |
| InChIKey | IZJGNJUZUMROJS-IBGZPJMESA-N |
| XLogP | 5.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |