C22H31N3O4 — CID 71958284
ethyl 5-tert-butyl-1-[4-(3-ethoxypropylcarbamoyl)phenyl]pyrazole-3-carboxylate (PubChem CID 71958284) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1-[4-(3-ethoxypropylcarbamoyl)phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-tert-butyl-1-[4-(3-ethoxypropylcarbamoyl)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 71958284 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | ethyl 5-tert-butyl-1-[4-(3-ethoxypropylcarbamoyl)phenyl]pyrazole-3-carboxylate |
| SMILES | CCOCCCNC(=O)c1ccc(-n2nc(C(=O)OCC)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31N3O4/c1-6-28-14-8-13-23-20(26)16-9-11-17(12-10-16)25-19(22(3,4)5)15-18(24-25)21(27)29-7-2/h9-12,15H,6-8,13-14H2,1-5H3,(H,23,26) |
| InChIKey | AGAURJSAJBAIDU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|