C23H18ClFN4O — CID 92771894
2-chloro-N-[[4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-6-methylpyridine-4-carboxamide (PubChem CID 92771894) has the molecular formula C23H18ClFN4O and a molecular weight of 420.88 g/mol. Its IUPAC name is 2-chloro-N-[[4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-6-methylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[[4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 92771894 |
| Molecular Formula | C23H18ClFN4O |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-chloro-N-[[4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-6-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(-c3ncc(-c4ccc(F)cc4)[nH]3)cc2)cc(Cl)n1 |
| InChI | InChI=1S/C23H18ClFN4O/c1-14-10-18(11-21(24)28-14)23(30)27-12-15-2-4-17(5-3-15)22-26-13-20(29-22)16-6-8-19(25)9-7-16/h2-11,13H,12H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | JMNRVCOELUQMAT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|