C19H16Cl3N3O2 — CID 91633898
2,2,2-trichloro-N-[[4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]acetamide (PubChem CID 91633898) has the molecular formula C19H16Cl3N3O2 and a molecular weight of 424.72 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 91633898 |
| Molecular Formula | C19H16Cl3N3O2 |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]acetamide |
| SMILES | COc1ccc(-c2cnc(-c3ccc(CNC(=O)C(Cl)(Cl)Cl)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C19H16Cl3N3O2/c1-27-15-8-6-13(7-9-15)16-11-23-17(25-16)14-4-2-12(3-5-14)10-24-18(26)19(20,21)22/h2-9,11H,10H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | HGYGDMRMQJPVCH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|