C29H31N3O — CID 92772347
(3R)-1-[4-(2-benzylbenzimidazol-1-yl)piperidin-1-yl]-3-phenylbutan-1-one (PubChem CID 92772347) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is (3R)-1-[4-(2-benzylbenzimidazol-1-yl)piperidin-1-yl]-3-phenylbutan-1-one.
| Compound Name | (3R)-1-[4-(2-benzylbenzimidazol-1-yl)piperidin-1-yl]-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 92772347 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (3R)-1-[4-(2-benzylbenzimidazol-1-yl)piperidin-1-yl]-3-phenylbutan-1-one |
| SMILES | C[C@H](CC(=O)N1CCC(n2c(Cc3ccccc3)nc3ccccc32)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H31N3O/c1-22(24-12-6-3-7-13-24)20-29(33)31-18-16-25(17-19-31)32-27-15-9-8-14-26(27)30-28(32)21-23-10-4-2-5-11-23/h2-15,22,25H,16-21H2,1H3/t22-/m1/s1 |
| InChIKey | VUQQSYAVFCUHKI-JOCHJYFZSA-N |
| XLogP | 5.98 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |