C25H32N4O2 — CID 9277369
2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide (PubChem CID 9277369) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide.
| Compound Name | 2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 9277369 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-[(5S,7R)-3-hydroxy-1-adamantyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide |
| SMILES | O=C(CC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2)Nc1ccc(-c2nnc3n2CCCCC3)cc1 |
| InChI | InChI=1S/C25H32N4O2/c30-22(15-24-11-17-10-18(12-24)14-25(31,13-17)16-24)26-20-7-5-19(6-8-20)23-28-27-21-4-2-1-3-9-29(21)23/h5-8,17-18,31H,1-4,9-16H2,(H,26,30)/t17-,18+,24?,25? |
| InChIKey | KOHZAUQQBXDIER-FLCJAFJVSA-N |
| XLogP | 4.33 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |