C14H20N2O6S — CID 9277760
methyl (2R)-3-hydroxy-2-[3-[(4-methylphenyl)sulfonylamino]propanoylamino]propanoate (PubChem CID 9277760) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl (2R)-3-hydroxy-2-[3-[(4-methylphenyl)sulfonylamino]propanoylamino]propanoate.
| Compound Name | methyl (2R)-3-hydroxy-2-[3-[(4-methylphenyl)sulfonylamino]propanoylamino]propanoate |
|---|---|
| PubChem CID | 9277760 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl (2R)-3-hydroxy-2-[3-[(4-methylphenyl)sulfonylamino]propanoylamino]propanoate |
| SMILES | COC(=O)[C@@H](CO)NC(=O)CCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H20N2O6S/c1-10-3-5-11(6-4-10)23(20,21)15-8-7-13(18)16-12(9-17)14(19)22-2/h3-6,12,15,17H,7-9H2,1-2H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | WLZHWBNNAVYESW-GFCCVEGCSA-N |
| XLogP | -0.69 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |