C19H26N4O5S — CID 92784237
(2-acetamido-1,3-thiazol-4-yl)methyl 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 92784237) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is (2-acetamido-1,3-thiazol-4-yl)methyl 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | (2-acetamido-1,3-thiazol-4-yl)methyl 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 92784237 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (2-acetamido-1,3-thiazol-4-yl)methyl 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CC(=O)Nc1nc(COC(=O)CN2C(=O)N[C@]3(C[C@H](C)CC(C)(C)C3)C2=O)cs1 |
| InChI | InChI=1S/C19H26N4O5S/c1-11-5-18(3,4)10-19(6-11)15(26)23(17(27)22-19)7-14(25)28-8-13-9-29-16(21-13)20-12(2)24/h9,11H,5-8,10H2,1-4H3,(H,22,27)(H,20,21,24)/t11-,19+/m1/s1 |
| InChIKey | FLLQHGVIPPDPFT-WYRIXSBYSA-N |
| XLogP | 2.28 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|