C23H34N5OS+ — CID 9279618
1-[3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 9279618) has the molecular formula C23H34N5OS+ and a molecular weight of 428.63 g/mol. Its IUPAC name is 1-[3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9279618 |
| Molecular Formula | C23H34N5OS+ |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-[3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CC1CC[NH+](Cc2nc(NCCCN3CCCC3=O)c3c4c(sc3n2)CCC4)CC1 |
| InChI | InChI=1S/C23H33N5OS/c1-16-8-13-27(14-9-16)15-19-25-22(24-10-4-12-28-11-3-7-20(28)29)21-17-5-2-6-18(17)30-23(21)26-19/h16H,2-15H2,1H3,(H,24,25,26)/p+1 |
| InChIKey | GCAFKYMWFOADAX-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|