C24H33N6O2S+ — CID 2531723
3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2531723) has the molecular formula C24H33N6O2S+ and a molecular weight of 469.64 g/mol. Its IUPAC name is 3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2531723 |
| Molecular Formula | C24H33N6O2S+ |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 3-[[10-[(4-methylpiperidin-1-ium-1-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CC[NH+](Cc2nc(NN3C(=O)NC4(CCCCC4)C3=O)c3c4c(sc3n2)CCC4)CC1 |
| InChI | InChI=1S/C24H32N6O2S/c1-15-8-12-29(13-9-15)14-18-25-20(19-16-6-5-7-17(16)33-21(19)26-18)28-30-22(31)24(27-23(30)32)10-3-2-4-11-24/h15H,2-14H2,1H3,(H,27,32)(H,25,26,28)/p+1 |
| InChIKey | RMYNMAKWITWSDU-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|