C20H29N4O2S+ — CID 9211284
(2R,6R)-2,6-dimethyl-4-[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]morpholine (PubChem CID 9211284) has the molecular formula C20H29N4O2S+ and a molecular weight of 389.55 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]morpholine.
| Compound Name | (2R,6R)-2,6-dimethyl-4-[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]morpholine |
|---|---|
| PubChem CID | 9211284 |
| Molecular Formula | C20H29N4O2S+ |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]morpholine |
| SMILES | C[C@@H]1CN(c2nc(C[NH+]3CCOCC3)nc3sc4c(c23)CCC4)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H28N4O2S/c1-13-10-24(11-14(2)26-13)19-18-15-4-3-5-16(15)27-20(18)22-17(21-19)12-23-6-8-25-9-7-23/h13-14H,3-12H2,1-2H3/p+1/t13-,14-/m1/s1 |
| InChIKey | DCDZFVSRYIAKAN-ZIAGYGMSSA-O |
| XLogP | 1.21 |
| TPSA | 51.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |