C19H27N4OS3+ — CID 9311754
[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl] N,N-diethylcarbamodithioate (PubChem CID 9311754) has the molecular formula C19H27N4OS3+ and a molecular weight of 423.65 g/mol. Its IUPAC name is [10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl] N,N-diethylcarbamodithioate.
| Compound Name | [10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 9311754 |
| Molecular Formula | C19H27N4OS3+ |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1nc(C[NH+]2CCOCC2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C19H26N4OS3/c1-3-23(4-2)19(25)27-18-16-13-6-5-7-14(13)26-17(16)20-15(21-18)12-22-8-10-24-11-9-22/h3-12H2,1-2H3/p+1 |
| InChIKey | GGSUSIFGTPOTJB-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|